C19H24ClN3O — CID 78214916
2-[benzyl-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]amino]ethanol (PubChem CID 78214916) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-[benzyl-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]amino]ethanol.
| Compound Name | 2-[benzyl-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 78214916 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-[benzyl-[[3-(4-chlorophenyl)pyrazolidin-4-yl]methyl]amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)CC1CNNC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O/c20-18-8-6-16(7-9-18)19-17(12-21-22-19)14-23(10-11-24)13-15-4-2-1-3-5-15/h1-9,17,19,21-22,24H,10-14H2 |
| InChIKey | RQZHNQMILWCBLF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |