C18H24N4O2S — CID 75258095
ethyl 4-[[pyridin-3-ylmethyl(thiophen-3-ylmethyl)amino]methyl]pyrazolidine-3-carboxylate (PubChem CID 75258095) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is ethyl 4-[[pyridin-3-ylmethyl(thiophen-3-ylmethyl)amino]methyl]pyrazolidine-3-carboxylate.
| Compound Name | ethyl 4-[[pyridin-3-ylmethyl(thiophen-3-ylmethyl)amino]methyl]pyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 75258095 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | ethyl 4-[[pyridin-3-ylmethyl(thiophen-3-ylmethyl)amino]methyl]pyrazolidine-3-carboxylate |
| SMILES | CCOC(=O)C1NNCC1CN(Cc1cccnc1)Cc1ccsc1 |
| InChI | InChI=1S/C18H24N4O2S/c1-2-24-18(23)17-16(9-20-21-17)12-22(11-15-5-7-25-13-15)10-14-4-3-6-19-8-14/h3-8,13,16-17,20-21H,2,9-12H2,1H3 |
| InChIKey | GYBXFWWVJGMJAW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |