C15H16N4S — CID 46987735
N-(1H-imidazol-2-ylmethyl)-1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine (PubChem CID 46987735) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 46987735 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine |
| SMILES | c1cncc(CN(Cc2ccsc2)Cc2ncc[nH]2)c1 |
| InChI | InChI=1S/C15H16N4S/c1-2-13(8-16-4-1)9-19(10-14-3-7-20-12-14)11-15-17-5-6-18-15/h1-8,12H,9-11H2,(H,17,18) |
| InChIKey | LDPKHXKKPGZDAW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |