C13H14N2O4S — CID 171155059
oxalic acid;1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine (PubChem CID 171155059) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is oxalic acid;1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine.
| Compound Name | oxalic acid;1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 171155059 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | oxalic acid;1-pyridin-3-yl-N-(thiophen-3-ylmethyl)methanamine |
| SMILES | O=C(O)C(=O)O.c1cncc(CNCc2ccsc2)c1 |
| InChI | InChI=1S/C11H12N2S.C2H2O4/c1-2-10(6-12-4-1)7-13-8-11-3-5-14-9-11;3-1(4)2(5)6/h1-6,9,13H,7-8H2;(H,3,4)(H,5,6) |
| InChIKey | HNMHNUOLXMJEFE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|