C21H28N3O4S+ — CID 7526188
N'-(2,2-dimethoxyethyl)-N-[(2R)-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-2-thiophen-2-ylethyl]oxamide (PubChem CID 7526188) has the molecular formula C21H28N3O4S+ and a molecular weight of 418.54 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N-[(2R)-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-2-thiophen-2-ylethyl]oxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)-N-[(2R)-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-2-thiophen-2-ylethyl]oxamide |
|---|---|
| PubChem CID | 7526188 |
| Molecular Formula | C21H28N3O4S+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N-[(2R)-2-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)-2-thiophen-2-ylethyl]oxamide |
| SMILES | COC(CNC(=O)C(=O)NC[C@H](c1cccs1)[NH+]1CCc2ccccc2C1)OC |
| InChI | InChI=1S/C21H27N3O4S/c1-27-19(28-2)13-23-21(26)20(25)22-12-17(18-8-5-11-29-18)24-10-9-15-6-3-4-7-16(15)14-24/h3-8,11,17,19H,9-10,12-14H2,1-2H3,(H,22,25)(H,23,26)/p+1/t17-/m1/s1 |
| InChIKey | MZGHWRDQTOHZNG-QGZVFWFLSA-O |
| XLogP | 0.28 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|