C18H30N4O — CID 75268969
1-ethyl-N-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-3-amine (PubChem CID 75268969) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-ethyl-N-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-3-amine.
| Compound Name | 1-ethyl-N-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 75268969 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 1-ethyl-N-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-3-amine |
| SMILES | CCN1CCCC(NCC2CNNC2c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C18H30N4O/c1-3-22-10-4-5-16(13-22)19-11-15-12-20-21-18(15)14-6-8-17(23-2)9-7-14/h6-9,15-16,18-21H,3-5,10-13H2,1-2H3 |
| InChIKey | TVGYCGRAFGNKOP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 48.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |