C20H28N6O — CID 134127387
4-[1-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]pyrimidin-2-amine (PubChem CID 134127387) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 4-[1-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | 4-[1-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134127387 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-[1-[[3-(4-methoxyphenyl)pyrazolidin-4-yl]methyl]piperidin-4-yl]pyrimidin-2-amine |
| SMILES | COc1ccc(C2NNCC2CN2CCC(c3ccnc(N)n3)CC2)cc1 |
| InChI | InChI=1S/C20H28N6O/c1-27-17-4-2-15(3-5-17)19-16(12-23-25-19)13-26-10-7-14(8-11-26)18-6-9-22-20(21)24-18/h2-6,9,14,16,19,23,25H,7-8,10-13H2,1H3,(H2,21,22,24) |
| InChIKey | NDJIEINFHKLKDC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |