C19H33ClN4O — CID 75268971
1-(3-tert-butylpyrazolidin-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine;hydrochloride (PubChem CID 75268971) has the molecular formula C19H33ClN4O and a molecular weight of 368.95 g/mol. Its IUPAC name is 1-(3-tert-butylpyrazolidin-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine;hydrochloride.
| Compound Name | 1-(3-tert-butylpyrazolidin-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 75268971 |
| Molecular Formula | C19H33ClN4O |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-(3-tert-butylpyrazolidin-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]methanamine;hydrochloride |
| SMILES | CC(C)(C)C1NNCC1CNCc1ccc(N2CCOCC2)cc1.Cl |
| InChI | InChI=1S/C19H32N4O.ClH/c1-19(2,3)18-16(14-21-22-18)13-20-12-15-4-6-17(7-5-15)23-8-10-24-11-9-23;/h4-7,16,18,20-22H,8-14H2,1-3H3;1H |
| InChIKey | SBEOGOPOYXWSPF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 48.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|