C34H53NO3 — CID 75269406
N-(4-butylphenyl)-4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide (PubChem CID 75269406) has the molecular formula C34H53NO3 and a molecular weight of 523.80 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide.
| Compound Name | N-(4-butylphenyl)-4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide |
|---|---|
| PubChem CID | 75269406 |
| Molecular Formula | C34H53NO3 |
| Molecular Weight | 523.80 g/mol |
| Exact Mass | 523.40 |
| IUPAC Name | N-(4-butylphenyl)-4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide |
| SMILES | CCCCc1ccc(NC(=O)CCC(C)C2CCC3C4C(O)CC5CC(O)CCC5(C)C4CCC23C)cc1 |
| InChI | InChI=1S/C34H53NO3/c1-5-6-7-23-9-11-25(12-10-23)35-31(38)15-8-22(2)27-13-14-28-32-29(17-19-34(27,28)4)33(3)18-16-26(36)20-24(33)21-30(32)37/h9-12,22,24,26-30,32,36-37H,5-8,13-21H2,1-4H3,(H,35,38) |
| InChIKey | KBXZUEDTIWIWEM-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.80 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |