C22H30N4O4S — CID 75270307
3-[(4-ethoxyphenyl)sulfamoyl]-5-methyl-N-(4-propan-2-ylphenyl)pyrazolidine-4-carboxamide (PubChem CID 75270307) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfamoyl]-5-methyl-N-(4-propan-2-ylphenyl)pyrazolidine-4-carboxamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfamoyl]-5-methyl-N-(4-propan-2-ylphenyl)pyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 75270307 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfamoyl]-5-methyl-N-(4-propan-2-ylphenyl)pyrazolidine-4-carboxamide |
| SMILES | CCOc1ccc(NS(=O)(=O)C2NNC(C)C2C(=O)Nc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O4S/c1-5-30-19-12-10-18(11-13-19)26-31(28,29)22-20(15(4)24-25-22)21(27)23-17-8-6-16(7-9-17)14(2)3/h6-15,20,22,24-26H,5H2,1-4H3,(H,23,27) |
| InChIKey | POPMLYWHUVPBRY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |