C19H24N4O5S — CID 75196957
5-[(4-ethoxyphenyl)sulfamoyl]-N-(4-methoxyphenyl)pyrazolidine-3-carboxamide (PubChem CID 75196957) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is 5-[(4-ethoxyphenyl)sulfamoyl]-N-(4-methoxyphenyl)pyrazolidine-3-carboxamide.
| Compound Name | 5-[(4-ethoxyphenyl)sulfamoyl]-N-(4-methoxyphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75196957 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 5-[(4-ethoxyphenyl)sulfamoyl]-N-(4-methoxyphenyl)pyrazolidine-3-carboxamide |
| SMILES | CCOc1ccc(NS(=O)(=O)C2CC(C(=O)Nc3ccc(OC)cc3)NN2)cc1 |
| InChI | InChI=1S/C19H24N4O5S/c1-3-28-16-10-6-14(7-11-16)23-29(25,26)18-12-17(21-22-18)19(24)20-13-4-8-15(27-2)9-5-13/h4-11,17-18,21-23H,3,12H2,1-2H3,(H,20,24) |
| InChIKey | SCLPNBQADSQNJF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |