C24H29FN4O4S — CID 75271319
N-(3,5-dimethoxyphenyl)-2-[[6-[(4-fluorophenyl)methyl]-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 75271319) has the molecular formula C24H29FN4O4S and a molecular weight of 488.59 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[[6-[(4-fluorophenyl)methyl]-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[[6-[(4-fluorophenyl)methyl]-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 75271319 |
| Molecular Formula | C24H29FN4O4S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[[6-[(4-fluorophenyl)methyl]-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | COc1cc(NC(=O)CSC2NC(=O)C3CN(Cc4ccc(F)cc4)CCC3N2)cc(OC)c1 |
| InChI | InChI=1S/C24H29FN4O4S/c1-32-18-9-17(10-19(11-18)33-2)26-22(30)14-34-24-27-21-7-8-29(13-20(21)23(31)28-24)12-15-3-5-16(25)6-4-15/h3-6,9-11,20-21,24,27H,7-8,12-14H2,1-2H3,(H,26,30)(H,28,31) |
| InChIKey | XRTLNXNPRMHCFZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |