C23H19N4O3S+ — CID 75271834
3-[(4-methylphenyl)methyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 75271834) has the molecular formula C23H19N4O3S+ and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 3-[(4-methylphenyl)methyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 75271834 |
| Molecular Formula | C23H19N4O3S+ |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-1-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)C3C=CC=CC3=[N+](Cc3nc(-c4cccs4)no3)C2=O)cc1 |
| InChI | InChI=1S/C23H19N4O3S/c1-15-8-10-16(11-9-15)13-27-22(28)17-5-2-3-6-18(17)26(23(27)29)14-20-24-21(25-30-20)19-7-4-12-31-19/h2-12,17H,13-14H2,1H3/q+1 |
| InChIKey | KWQVBKBURUZVBU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|