C21H19N2O2+ — CID 78601437
3-ethyl-1-(naphthalen-1-ylmethyl)-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 78601437) has the molecular formula C21H19N2O2+ and a molecular weight of 331.39 g/mol. Its IUPAC name is 3-ethyl-1-(naphthalen-1-ylmethyl)-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 3-ethyl-1-(naphthalen-1-ylmethyl)-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 78601437 |
| Molecular Formula | C21H19N2O2+ |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-ethyl-1-(naphthalen-1-ylmethyl)-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | CCN1C(=O)C2C=CC=CC2=[N+](Cc2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C21H19N2O2/c1-2-22-20(24)18-12-5-6-13-19(18)23(21(22)25)14-16-10-7-9-15-8-3-4-11-17(15)16/h3-13,18H,2,14H2,1H3/q+1 |
| InChIKey | WZYZLKILBWZXJP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|