C22H18ClN2O2+ — CID 73370467
3-(3-chlorophenyl)-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 73370467) has the molecular formula C22H18ClN2O2+ and a molecular weight of 377.85 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73370467 |
| Molecular Formula | C22H18ClN2O2+ |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | Cc1ccccc1C[N+]1=C2C=CC=CC2C(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C22H18ClN2O2/c1-15-7-2-3-8-16(15)14-24-20-12-5-4-11-19(20)21(26)25(22(24)27)18-10-6-9-17(23)13-18/h2-13,19H,14H2,1H3/q+1 |
| InChIKey | CACZDZLOMTYCIG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|