C28H28N3O3+ — CID 75185727
3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione (PubChem CID 75185727) has the molecular formula C28H28N3O3+ and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione.
| Compound Name | 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 75185727 |
| Molecular Formula | C28H28N3O3+ |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxopropyl]-1-[(2-methylphenyl)methyl]-4aH-quinazolin-1-ium-2,4-dione |
| SMILES | Cc1ccccc1C[N+]1=C2C=CC=CC2C(=O)N(CCC(=O)N2CCc3ccccc3C2)C1=O |
| InChI | InChI=1S/C28H28N3O3/c1-20-8-2-3-10-22(20)19-31-25-13-7-6-12-24(25)27(33)30(28(31)34)17-15-26(32)29-16-14-21-9-4-5-11-23(21)18-29/h2-13,24H,14-19H2,1H3/q+1 |
| InChIKey | GPVHBDNNQVKCKP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|