C32H35ClN5O4+ — CID 73328961
N-[(2-chlorophenyl)methyl]-5-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4aH-quinazolin-1-ium-3-yl]pentanamide (PubChem CID 73328961) has the molecular formula C32H35ClN5O4+ and a molecular weight of 589.12 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4aH-quinazolin-1-ium-3-yl]pentanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4aH-quinazolin-1-ium-3-yl]pentanamide |
|---|---|
| PubChem CID | 73328961 |
| Molecular Formula | C32H35ClN5O4+ |
| Molecular Weight | 589.12 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-4aH-quinazolin-1-ium-3-yl]pentanamide |
| SMILES | O=C(CCCCN1C(=O)C2C=CC=CC2=[N+](CC(=O)N2CCN(c3ccccc3)CC2)C1=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C32H34ClN5O4/c33-27-14-6-4-10-24(27)22-34-29(39)16-8-9-17-37-31(41)26-13-5-7-15-28(26)38(32(37)42)23-30(40)36-20-18-35(19-21-36)25-11-2-1-3-12-25/h1-7,10-15,26H,8-9,16-23H2/p+1 |
| InChIKey | CZVMHHYLXIAPFS-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|