C19H21ClN3O3S+ — CID 75255928
2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 75255928) has the molecular formula C19H21ClN3O3S+ and a molecular weight of 406.92 g/mol. Its IUPAC name is 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 75255928 |
| Molecular Formula | C19H21ClN3O3S+ |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | CCCCN1C(=O)C2SC=CC2=[N+](CC(=O)NCc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C19H20ClN3O3S/c1-2-3-9-22-18(25)17-15(8-10-27-17)23(19(22)26)12-16(24)21-11-13-6-4-5-7-14(13)20/h4-8,10,17H,2-3,9,11-12H2,1H3/p+1 |
| InChIKey | YZAKZAGJOMPPNB-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 69.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|