C18H22N3O3S2+ — CID 75285847
N-butyl-2-[2,4-dioxo-3-(2-thiophen-2-ylethyl)-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide (PubChem CID 75285847) has the molecular formula C18H22N3O3S2+ and a molecular weight of 392.53 g/mol. Its IUPAC name is N-butyl-2-[2,4-dioxo-3-(2-thiophen-2-ylethyl)-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide.
| Compound Name | N-butyl-2-[2,4-dioxo-3-(2-thiophen-2-ylethyl)-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 75285847 |
| Molecular Formula | C18H22N3O3S2+ |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-butyl-2-[2,4-dioxo-3-(2-thiophen-2-ylethyl)-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl]acetamide |
| SMILES | CCCCNC(=O)C[N+]1=C2C=CSC2C(=O)N(CCc2cccs2)C1=O |
| InChI | InChI=1S/C18H21N3O3S2/c1-2-3-8-19-15(22)12-21-14-7-11-26-16(14)17(23)20(18(21)24)9-6-13-5-4-10-25-13/h4-5,7,10-11,16H,2-3,6,8-9,12H2,1H3/p+1 |
| InChIKey | CFXFWFIDQYPTGJ-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 69.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|