C19H28N3O3S+ — CID 75255971
2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-cyclohexyl-N-methylacetamide (PubChem CID 75255971) has the molecular formula C19H28N3O3S+ and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 75255971 |
| Molecular Formula | C19H28N3O3S+ |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-(3-butyl-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-1-yl)-N-cyclohexyl-N-methylacetamide |
| SMILES | CCCCN1C(=O)C2SC=CC2=[N+](CC(=O)N(C)C2CCCCC2)C1=O |
| InChI | InChI=1S/C19H28N3O3S/c1-3-4-11-21-18(24)17-15(10-12-26-17)22(19(21)25)13-16(23)20(2)14-8-6-5-7-9-14/h10,12,14,17H,3-9,11,13H2,1-2H3/q+1 |
| InChIKey | AAODFGVXNOJXSW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|