C20H20ClN5O3S — CID 53199387
2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 53199387) has the molecular formula C20H20ClN5O3S and a molecular weight of 445.93 g/mol. Its IUPAC name is 2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 53199387 |
| Molecular Formula | C20H20ClN5O3S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | CCCCn1c(=O)c2sccc2n2c(=O)n(CC(=O)NCc3ccccc3Cl)nc12 |
| InChI | InChI=1S/C20H20ClN5O3S/c1-2-3-9-24-18(28)17-15(8-10-30-17)26-19(24)23-25(20(26)29)12-16(27)22-11-13-6-4-5-7-14(13)21/h4-8,10H,2-3,9,11-12H2,1H3,(H,22,27) |
| InChIKey | KWIZQKLVXHRZKK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |