C21H23N5O3S — CID 53199416
2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-(2,5-dimethylphenyl)acetamide (PubChem CID 53199416) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 53199416 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-(8-butyl-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl)-N-(2,5-dimethylphenyl)acetamide |
| SMILES | CCCCn1c(=O)c2sccc2n2c(=O)n(CC(=O)Nc3cc(C)ccc3C)nc12 |
| InChI | InChI=1S/C21H23N5O3S/c1-4-5-9-24-19(28)18-16(8-10-30-18)26-20(24)23-25(21(26)29)12-17(27)22-15-11-13(2)6-7-14(15)3/h6-8,10-11H,4-5,9,12H2,1-3H3,(H,22,27) |
| InChIKey | WCGSEDIXNJCBRO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |