C22H24N4O3S — CID 53074699
8-butyl-11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione (PubChem CID 53074699) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 8-butyl-11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione.
| Compound Name | 8-butyl-11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
|---|---|
| PubChem CID | 53074699 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 8-butyl-11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
| SMILES | CCCCn1c(=O)c2sccc2n2c(=O)n(CC(=O)c3cc(C)c(C)cc3C)nc12 |
| InChI | InChI=1S/C22H24N4O3S/c1-5-6-8-24-20(28)19-17(7-9-30-19)26-21(24)23-25(22(26)29)12-18(27)16-11-14(3)13(2)10-15(16)4/h7,9-11H,5-6,8,12H2,1-4H3 |
| InChIKey | YJHXTHZRMLCWGG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |