C21H22N4O5S — CID 53074687
11-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-8-(2-methylpropyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione (PubChem CID 53074687) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 11-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-8-(2-methylpropyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione.
| Compound Name | 11-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-8-(2-methylpropyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
|---|---|
| PubChem CID | 53074687 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 11-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-8-(2-methylpropyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
| SMILES | COc1ccc(C(=O)Cn2nc3n(CC(C)C)c(=O)c4sccc4n3c2=O)cc1OC |
| InChI | InChI=1S/C21H22N4O5S/c1-12(2)10-23-19(27)18-14(7-8-31-18)25-20(23)22-24(21(25)28)11-15(26)13-5-6-16(29-3)17(9-13)30-4/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | AORONIANANJEPY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 96.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |