C21H22ClN5O4S — CID 53199242
N-(3-chloro-4-methoxyphenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide (PubChem CID 53199242) has the molecular formula C21H22ClN5O4S and a molecular weight of 475.96 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
|---|---|
| PubChem CID | 53199242 |
| Molecular Formula | C21H22ClN5O4S |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cn2nc3n(CCC(C)C)c(=O)c4sccc4n3c2=O)cc1Cl |
| InChI | InChI=1S/C21H22ClN5O4S/c1-12(2)6-8-25-19(29)18-15(7-9-32-18)27-20(25)24-26(21(27)30)11-17(28)23-13-4-5-16(31-3)14(22)10-13/h4-5,7,9-10,12H,6,8,11H2,1-3H3,(H,23,28) |
| InChIKey | NXKLIUWISPBUBX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |