C20H20FN5O3S — CID 53199278
N-(2-fluorophenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide (PubChem CID 53199278) has the molecular formula C20H20FN5O3S and a molecular weight of 429.48 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
|---|---|
| PubChem CID | 53199278 |
| Molecular Formula | C20H20FN5O3S |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-(2-fluorophenyl)-2-[8-(3-methylbutyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
| SMILES | CC(C)CCn1c(=O)c2sccc2n2c(=O)n(CC(=O)Nc3ccccc3F)nc12 |
| InChI | InChI=1S/C20H20FN5O3S/c1-12(2)7-9-24-18(28)17-15(8-10-30-17)26-19(24)23-25(20(26)29)11-16(27)22-14-6-4-3-5-13(14)21/h3-6,8,10,12H,7,9,11H2,1-2H3,(H,22,27) |
| InChIKey | IRRZXHRLSFRPSN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |