C20H14FN5O4S — CID 53199595
N-(2-fluorophenyl)-2-[8-(furan-2-ylmethyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide (PubChem CID 53199595) has the molecular formula C20H14FN5O4S and a molecular weight of 439.43 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[8-(furan-2-ylmethyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[8-(furan-2-ylmethyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
|---|---|
| PubChem CID | 53199595 |
| Molecular Formula | C20H14FN5O4S |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-(2-fluorophenyl)-2-[8-(furan-2-ylmethyl)-7,12-dioxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
| SMILES | O=C(Cn1nc2n(Cc3ccco3)c(=O)c3sccc3n2c1=O)Nc1ccccc1F |
| InChI | InChI=1S/C20H14FN5O4S/c21-13-5-1-2-6-14(13)22-16(27)11-25-20(29)26-15-7-9-31-17(15)18(28)24(19(26)23-25)10-12-4-3-8-30-12/h1-9H,10-11H2,(H,22,27) |
| InChIKey | BGBXUFRXAIXAHE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |