C20H14FN5O3S2 — CID 53199496
2-[7,12-dioxo-8-(thiophen-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 53199496) has the molecular formula C20H14FN5O3S2 and a molecular weight of 455.50 g/mol. Its IUPAC name is 2-[7,12-dioxo-8-(thiophen-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[7,12-dioxo-8-(thiophen-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 53199496 |
| Molecular Formula | C20H14FN5O3S2 |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-[7,12-dioxo-8-(thiophen-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cn1nc2n(Cc3cccs3)c(=O)c3sccc3n2c1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H14FN5O3S2/c21-12-3-1-4-13(9-12)22-16(27)11-25-20(29)26-15-6-8-31-17(15)18(28)24(19(26)23-25)10-14-5-2-7-30-14/h1-9H,10-11H2,(H,22,27) |
| InChIKey | OBECGQHIPBEOCZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |