C22H23N5O4S — CID 95113586
N-(3,4-dimethylphenyl)-2-[7,12-dioxo-8-[[(2S)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide (PubChem CID 95113586) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[7,12-dioxo-8-[[(2S)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[7,12-dioxo-8-[[(2S)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
|---|---|
| PubChem CID | 95113586 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[7,12-dioxo-8-[[(2S)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nc3n(C[C@@H]4CCCO4)c(=O)c4sccc4n3c2=O)cc1C |
| InChI | InChI=1S/C22H23N5O4S/c1-13-5-6-15(10-14(13)2)23-18(28)12-26-22(30)27-17-7-9-32-19(17)20(29)25(21(27)24-26)11-16-4-3-8-31-16/h5-7,9-10,16H,3-4,8,11-12H2,1-2H3,(H,23,28)/t16-/m0/s1 |
| InChIKey | XDIUIUYZWKICAN-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |