C20H25N5O4S — CID 171688085
N-cyclohexyl-2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide (PubChem CID 171688085) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-cyclohexyl-2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
|---|---|
| PubChem CID | 171688085 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-cyclohexyl-2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
| SMILES | O=C(Cn1nc2n(CC3CCCO3)c(=O)c3sccc3n2c1=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H25N5O4S/c26-16(21-13-5-2-1-3-6-13)12-24-20(28)25-15-8-10-30-17(15)18(27)23(19(25)22-24)11-14-7-4-9-29-14/h8,10,13-14H,1-7,9,11-12H2,(H,21,26) |
| InChIKey | ZQJLIGQOMCHRLW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |