C22H23N5O4S — CID 95113589
2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 95113589) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 95113589 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)Cn1nc2n(C[C@H]3CCCO3)c(=O)c3sccc3n2c1=O |
| InChI | InChI=1S/C22H23N5O4S/c1-2-14-6-3-4-8-16(14)23-18(28)13-26-22(30)27-17-9-11-32-19(17)20(29)25(21(27)24-26)12-15-7-5-10-31-15/h3-4,6,8-9,11,15H,2,5,7,10,12-13H2,1H3,(H,23,28)/t15-/m1/s1 |
| InChIKey | YEXIQGXBGOVGRF-OAHLLOKOSA-N |
| XLogP | 2.25 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |