C22H23N5O5S — CID 53199550
2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 53199550) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 53199550 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-[7,12-dioxo-8-(oxolan-2-ylmethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(CNC(=O)Cn2nc3n(CC4CCCO4)c(=O)c4sccc4n3c2=O)c1 |
| InChI | InChI=1S/C22H23N5O5S/c1-31-15-5-2-4-14(10-15)11-23-18(28)13-26-22(30)27-17-7-9-33-19(17)20(29)25(21(27)24-26)12-16-6-3-8-32-16/h2,4-5,7,9-10,16H,3,6,8,11-13H2,1H3,(H,23,28) |
| InChIKey | HZYLNDCZLIAWSF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |