C20H17F2N5O4S — CID 95113621
N-(3,4-difluorophenyl)-2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide (PubChem CID 95113621) has the molecular formula C20H17F2N5O4S and a molecular weight of 461.45 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
|---|---|
| PubChem CID | 95113621 |
| Molecular Formula | C20H17F2N5O4S |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[7,12-dioxo-8-[[(2R)-oxolan-2-yl]methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-trien-11-yl]acetamide |
| SMILES | O=C(Cn1nc2n(C[C@H]3CCCO3)c(=O)c3sccc3n2c1=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H17F2N5O4S/c21-13-4-3-11(8-14(13)22)23-16(28)10-26-20(30)27-15-5-7-32-17(15)18(29)25(19(27)24-26)9-12-2-1-6-31-12/h3-5,7-8,12H,1-2,6,9-10H2,(H,23,28)/t12-/m1/s1 |
| InChIKey | AALNVDLCFXIGPL-GFCCVEGCSA-N |
| XLogP | 1.97 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |