C26H24N4O3S — CID 53074665
11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-8-(2-phenylethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione (PubChem CID 53074665) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is 11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-8-(2-phenylethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione.
| Compound Name | 11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-8-(2-phenylethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
|---|---|
| PubChem CID | 53074665 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 11-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]-8-(2-phenylethyl)-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
| SMILES | Cc1cc(C)c(C(=O)Cn2nc3n(CCc4ccccc4)c(=O)c4sccc4n3c2=O)cc1C |
| InChI | InChI=1S/C26H24N4O3S/c1-16-13-18(3)20(14-17(16)2)22(31)15-29-26(33)30-21-10-12-34-23(21)24(32)28(25(30)27-29)11-9-19-7-5-4-6-8-19/h4-8,10,12-14H,9,11,15H2,1-3H3 |
| InChIKey | LDNRTTATUDQXRG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |