C22H21N4O6+ — CID 78313593
2-[3-(3,4-dimethoxyphenyl)-2,4-dioxo-4aH-quinazolin-1-ium-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 78313593) has the molecular formula C22H21N4O6+ and a molecular weight of 437.43 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)-2,4-dioxo-4aH-quinazolin-1-ium-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)-2,4-dioxo-4aH-quinazolin-1-ium-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 78313593 |
| Molecular Formula | C22H21N4O6+ |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)-2,4-dioxo-4aH-quinazolin-1-ium-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | COc1ccc(N2C(=O)C3C=CC=CC3=[N+](CC(=O)Nc3cc(C)on3)C2=O)cc1OC |
| InChI | InChI=1S/C22H20N4O6/c1-13-10-19(24-32-13)23-20(27)12-25-16-7-5-4-6-15(16)21(28)26(22(25)29)14-8-9-17(30-2)18(11-14)31-3/h4-11,15H,12H2,1-3H3/p+1 |
| InChIKey | PGSOGPZZYCGVNU-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|