C23H20N4O2S2 — CID 75278663
N-[2-[3-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 75278663) has the molecular formula C23H20N4O2S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[2-[3-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | N-[2-[3-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 75278663 |
| Molecular Formula | C23H20N4O2S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[2-[3-(4-methyl-2-thiophen-2-yl-1,3-thiazol-5-yl)-6-oxopyridazin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | Cc1nc(-c2cccs2)sc1-c1ccc(=O)n(CCNC(=O)C=Cc2ccccc2)n1 |
| InChI | InChI=1S/C23H20N4O2S2/c1-16-22(31-23(25-16)19-8-5-15-30-19)18-10-12-21(29)27(26-18)14-13-24-20(28)11-9-17-6-3-2-4-7-17/h2-12,15H,13-14H2,1H3,(H,24,28) |
| InChIKey | ZQQYDDYSPXLTEQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|