C22H26N6 — CID 75297693
5-(1-benzyl-5-phenyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-amine (PubChem CID 75297693) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-(1-benzyl-5-phenyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-amine.
| Compound Name | 5-(1-benzyl-5-phenyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 75297693 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 5-(1-benzyl-5-phenyltriazol-4-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-amine |
| SMILES | NC1NNC2CCC(c3nnn(Cc4ccccc4)c3-c3ccccc3)CC12 |
| InChI | InChI=1S/C22H26N6/c23-22-18-13-17(11-12-19(18)24-26-22)20-21(16-9-5-2-6-10-16)28(27-25-20)14-15-7-3-1-4-8-15/h1-10,17-19,22,24,26H,11-14,23H2 |
| InChIKey | TZQLUDQFUZIHCB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |