C25H31NO6 — CID 75297863
4-O-tert-butyl 1-O-(7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) butanedioate (PubChem CID 75297863) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-(7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) butanedioate |
|---|---|
| PubChem CID | 75297863 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 4-O-tert-butyl 1-O-(7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) butanedioate |
| SMILES | CN1CCC23c4c5ccc(OC(=O)CCC(=O)OC(C)(C)C)c4OC2C(O)C=CC3C1C5 |
| InChI | InChI=1S/C25H31NO6/c1-24(2,3)32-20(29)10-9-19(28)30-18-8-5-14-13-16-15-6-7-17(27)23-25(15,11-12-26(16)4)21(14)22(18)31-23/h5-8,15-17,23,27H,9-13H2,1-4H3 |
| InChIKey | LQVFBQMFHGMAAN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|