C16H22N4O3S — CID 75310726
4-ethoxy-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide (PubChem CID 75310726) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-ethoxy-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75310726 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-ethoxy-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC2CCCC(n3cnnc3)C2)cc1 |
| InChI | InChI=1S/C16H22N4O3S/c1-2-23-15-6-8-16(9-7-15)24(21,22)19-13-4-3-5-14(10-13)20-11-17-18-12-20/h6-9,11-14,19H,2-5,10H2,1H3 |
| InChIKey | HFDMAVWFZHWVQG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |