C22H26N4O2S — CID 75310882
3-ethyl-4-phenyl-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide (PubChem CID 75310882) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-ethyl-4-phenyl-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide.
| Compound Name | 3-ethyl-4-phenyl-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75310882 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-ethyl-4-phenyl-N-[3-(1,2,4-triazol-4-yl)cyclohexyl]benzenesulfonamide |
| SMILES | CCc1cc(S(=O)(=O)NC2CCCC(n3cnnc3)C2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C22H26N4O2S/c1-2-17-13-21(11-12-22(17)18-7-4-3-5-8-18)29(27,28)25-19-9-6-10-20(14-19)26-15-23-24-16-26/h3-5,7-8,11-13,15-16,19-20,25H,2,6,9-10,14H2,1H3 |
| InChIKey | KMUJTBBBBGLJPD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |