C18H19N5O3 — CID 7532840
(2S)-N,N-dimethyl-2-[1-(2-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanamide (PubChem CID 7532840) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-[1-(2-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanamide.
| Compound Name | (2S)-N,N-dimethyl-2-[1-(2-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanamide |
|---|---|
| PubChem CID | 7532840 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (2S)-N,N-dimethyl-2-[1-(2-methylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanamide |
| SMILES | CC(=O)[C@@H](C(=O)N(C)C)n1cnc2c(cnn2-c2ccccc2C)c1=O |
| InChI | InChI=1S/C18H19N5O3/c1-11-7-5-6-8-14(11)23-16-13(9-20-23)17(25)22(10-19-16)15(12(2)24)18(26)21(3)4/h5-10,15H,1-4H3/t15-/m0/s1 |
| InChIKey | WHCPDBAWLNYLNF-HNNXBMFYSA-N |
| XLogP | 1.11 |
| TPSA | 90.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|