C19H20N4O4 — CID 7532871
ethyl (2R)-2-[1-(2,3-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanoate (PubChem CID 7532871) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl (2R)-2-[1-(2,3-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-[1-(2,3-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7532871 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethyl (2R)-2-[1-(2,3-dimethylphenyl)-4-oxopyrazolo[5,4-d]pyrimidin-5-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](C(C)=O)n1cnc2c(cnn2-c2cccc(C)c2C)c1=O |
| InChI | InChI=1S/C19H20N4O4/c1-5-27-19(26)16(13(4)24)22-10-20-17-14(18(22)25)9-21-23(17)15-8-6-7-11(2)12(15)3/h6-10,16H,5H2,1-4H3/t16-/m1/s1 |
| InChIKey | VMDPKZTYCYFIJF-MRXNPFEDSA-N |
| XLogP | 1.89 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|