C22H15F3N2O — CID 7535347
2-naphthalen-1-yl-N-(2,2,2-trifluoroethyl)quinoline-4-carboxamide (PubChem CID 7535347) has the molecular formula C22H15F3N2O and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-(2,2,2-trifluoroethyl)quinoline-4-carboxamide.
| Compound Name | 2-naphthalen-1-yl-N-(2,2,2-trifluoroethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 7535347 |
| Molecular Formula | C22H15F3N2O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-naphthalen-1-yl-N-(2,2,2-trifluoroethyl)quinoline-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cc(-c2cccc3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C22H15F3N2O/c23-22(24,25)13-26-21(28)18-12-20(27-19-11-4-3-9-17(18)19)16-10-5-7-14-6-1-2-8-15(14)16/h1-12H,13H2,(H,26,28) |
| InChIKey | NDUNCJIVYKZIHP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |