C8H15N3O — CID 75355841
1-methyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 75355841) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-methyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 1-methyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 75355841 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 1-methyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CN1C(=O)NCC12CCNCC2 |
| InChI | InChI=1S/C8H15N3O/c1-11-7(12)10-6-8(11)2-4-9-5-3-8/h9H,2-6H2,1H3,(H,10,12) |
| InChIKey | GIHYAWRCQRJWNV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |