C9H10BrN3O — CID 75356273
5-(bromomethyl)-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole (PubChem CID 75356273) has the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole.
| Compound Name | 5-(bromomethyl)-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 75356273 |
| Molecular Formula | C9H10BrN3O |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 5-(bromomethyl)-3-(1,5-dimethylpyrazol-4-yl)-1,2-oxazole |
| SMILES | Cc1c(-c2cc(CBr)on2)cnn1C |
| InChI | InChI=1S/C9H10BrN3O/c1-6-8(5-11-13(6)2)9-3-7(4-10)14-12-9/h3,5H,4H2,1-2H3 |
| InChIKey | UTRCMPFPUJQDHA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|