C21H17F3N2O5 — CID 75356899
4-[3-methoxy-3-oxo-1-[3-oxo-5-[(2,4,5-trifluorophenyl)methyl]-1,2-dihydropyrazol-4-yl]propyl]benzoic acid (PubChem CID 75356899) has the molecular formula C21H17F3N2O5 and a molecular weight of 434.37 g/mol. Its IUPAC name is 4-[3-methoxy-3-oxo-1-[3-oxo-5-[(2,4,5-trifluorophenyl)methyl]-1,2-dihydropyrazol-4-yl]propyl]benzoic acid.
| Compound Name | 4-[3-methoxy-3-oxo-1-[3-oxo-5-[(2,4,5-trifluorophenyl)methyl]-1,2-dihydropyrazol-4-yl]propyl]benzoic acid |
|---|---|
| PubChem CID | 75356899 |
| Molecular Formula | C21H17F3N2O5 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 4-[3-methoxy-3-oxo-1-[3-oxo-5-[(2,4,5-trifluorophenyl)methyl]-1,2-dihydropyrazol-4-yl]propyl]benzoic acid |
| SMILES | COC(=O)CC(c1ccc(C(=O)O)cc1)c1c(Cc2cc(F)c(F)cc2F)[nH][nH]c1=O |
| InChI | InChI=1S/C21H17F3N2O5/c1-31-18(27)8-13(10-2-4-11(5-3-10)21(29)30)19-17(25-26-20(19)28)7-12-6-15(23)16(24)9-14(12)22/h2-6,9,13H,7-8H2,1H3,(H,29,30)(H2,25,26,28) |
| InChIKey | LEYFYVIQOWOQGD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|