C20H17F3N2O3 — CID 97426262
methyl (3S)-3-(3-benzyl-5-oxo-1,2-dihydropyrazol-4-yl)-3-(3,4,5-trifluorophenyl)propanoate (PubChem CID 97426262) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is methyl (3S)-3-(3-benzyl-5-oxo-1,2-dihydropyrazol-4-yl)-3-(3,4,5-trifluorophenyl)propanoate.
| Compound Name | methyl (3S)-3-(3-benzyl-5-oxo-1,2-dihydropyrazol-4-yl)-3-(3,4,5-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 97426262 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | methyl (3S)-3-(3-benzyl-5-oxo-1,2-dihydropyrazol-4-yl)-3-(3,4,5-trifluorophenyl)propanoate |
| SMILES | COC(=O)C[C@@H](c1cc(F)c(F)c(F)c1)c1c(Cc2ccccc2)[nH][nH]c1=O |
| InChI | InChI=1S/C20H17F3N2O3/c1-28-17(26)10-13(12-8-14(21)19(23)15(22)9-12)18-16(24-25-20(18)27)7-11-5-3-2-4-6-11/h2-6,8-9,13H,7,10H2,1H3,(H2,24,25,27)/t13-/m0/s1 |
| InChIKey | BHVZTKKHGXLCAJ-ZDUSSCGKSA-N |
| XLogP | 3.41 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|