C14H16N6OS — CID 75357570
2-(benzotriazol-1-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 75357570) has the molecular formula C14H16N6OS and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 75357570 |
| Molecular Formula | C14H16N6OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCc1nnc(NC(=O)C(CC)n2nnc3ccccc32)s1 |
| InChI | InChI=1S/C14H16N6OS/c1-3-10(13(21)15-14-18-17-12(4-2)22-14)20-11-8-6-5-7-9(11)16-19-20/h5-8,10H,3-4H2,1-2H3,(H,15,18,21) |
| InChIKey | PXDSPEKHMXIFJW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |