C11H9F2N3O2 — CID 75357925
methyl 5-amino-1-(2,4-difluorophenyl)pyrazole-4-carboxylate (PubChem CID 75357925) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is methyl 5-amino-1-(2,4-difluorophenyl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(2,4-difluorophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 75357925 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | methyl 5-amino-1-(2,4-difluorophenyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(-c2ccc(F)cc2F)c1N |
| InChI | InChI=1S/C11H9F2N3O2/c1-18-11(17)7-5-15-16(10(7)14)9-3-2-6(12)4-8(9)13/h2-5H,14H2,1H3 |
| InChIKey | RYGPGISEONBLKV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |