C19H14ClF2N5O2S — CID 2745686
methyl 5-[[(4-chlorophenyl)carbamothioylhydrazinylidene]methyl]-1-(2,4-difluorophenyl)pyrazole-4-carboxylate (PubChem CID 2745686) has the molecular formula C19H14ClF2N5O2S and a molecular weight of 449.87 g/mol. Its IUPAC name is methyl 5-[[(4-chlorophenyl)carbamothioylhydrazinylidene]methyl]-1-(2,4-difluorophenyl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-[[(4-chlorophenyl)carbamothioylhydrazinylidene]methyl]-1-(2,4-difluorophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2745686 |
| Molecular Formula | C19H14ClF2N5O2S |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | methyl 5-[[(4-chlorophenyl)carbamothioylhydrazinylidene]methyl]-1-(2,4-difluorophenyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(-c2ccc(F)cc2F)c1C=NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClF2N5O2S/c1-29-18(28)14-9-24-27(16-7-4-12(21)8-15(16)22)17(14)10-23-26-19(30)25-13-5-2-11(20)3-6-13/h2-10H,1H3,(H2,25,26,30) |
| InChIKey | RSLZFXYZLHFVJD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|